C10H20N2O5S — CID 80520002
N-(2,2-dimethoxyethyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide (PubChem CID 80520002) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
|---|---|
| PubChem CID | 80520002 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-(1,1-dioxo-1,4-thiazinan-3-yl)acetamide |
| SMILES | COC(CNC(=O)CC1CS(=O)(=O)CCN1)OC |
| InChI | InChI=1S/C10H20N2O5S/c1-16-10(17-2)6-12-9(13)5-8-7-18(14,15)4-3-11-8/h8,10-11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | OYQDEJVOUJOPSB-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|