C9H18N2O5S — CID 82723055
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-methoxyethoxy)acetamide (PubChem CID 82723055) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-methoxyethoxy)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 82723055 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(2-methoxyethoxy)acetamide |
| SMILES | COCCONC(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C9H18N2O5S/c1-15-3-4-16-11-9(12)6-8-7-17(13,14)5-2-10-8/h8,10H,2-7H2,1H3,(H,11,12) |
| InChIKey | IHJRQIUWPDXGCL-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|