C9H17NO4S — CID 80518970
propyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate (PubChem CID 80518970) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is propyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate.
| Compound Name | propyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate |
|---|---|
| PubChem CID | 80518970 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | propyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate |
| SMILES | CCCOC(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C9H17NO4S/c1-2-4-14-9(11)6-8-7-15(12,13)5-3-10-8/h8,10H,2-7H2,1H3 |
| InChIKey | DPMCXGQACBXNGA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |