C14H19NO5S — CID 80515046
(3-methoxyphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate (PubChem CID 80515046) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate.
| Compound Name | (3-methoxyphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate |
|---|---|
| PubChem CID | 80515046 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate |
| SMILES | COc1cccc(COC(=O)CC2CS(=O)(=O)CCN2)c1 |
| InChI | InChI=1S/C14H19NO5S/c1-19-13-4-2-3-11(7-13)9-20-14(16)8-12-10-21(17,18)6-5-15-12/h2-4,7,12,15H,5-6,8-10H2,1H3 |
| InChIKey | FPPIKJCMQXAPQS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |