C12H12Cl2O3 — CID 78790601
(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 78790601) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 78790601 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | COc1cccc(COC(=O)C2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C12H12Cl2O3/c1-16-9-4-2-3-8(5-9)7-17-11(15)10-6-12(10,13)14/h2-5,10H,6-7H2,1H3 |
| InChIKey | PUVZKPAHNBNRAR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|