(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate

C12H12Cl2O3 — CID 78790601

IUPAC(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate
SMILESCOc1cccc(COC(=O)C2CC2(Cl)Cl)c1
InChIInChI=1S/C12H12Cl2O3/c1-16-9-4-2-3-8(5-9)7-17-11(15)10-6-12(10,13)14/h2-5,10H,6-7H2,1H3
InChIKeyPUVZKPAHNBNRAR-UHFFFAOYSA-N
MW275.13 g/mol
LogP2.93
Rot. Bonds4

About (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate

(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 78790601) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate.

Molecular Properties

Compound Name(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate
PubChem CID78790601
Molecular FormulaC12H12Cl2O3
Molecular Weight275.13 g/mol
Exact Mass274.02
IUPAC Name(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate
SMILESCOc1cccc(COC(=O)C2CC2(Cl)Cl)c1
InChIInChI=1S/C12H12Cl2O3/c1-16-9-4-2-3-8(5-9)7-17-11(15)10-6-12(10,13)14/h2-5,10H,6-7H2,1H3
InChIKeyPUVZKPAHNBNRAR-UHFFFAOYSA-N
XLogP2.93
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.13
LogP ≤ 52.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate?
The IUPAC name of (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate (CID 78790601) is (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate?
The canonical SMILES for (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate is COc1cccc(COC(=O)C2CC2(Cl)Cl)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate?
The InChIKey is PUVZKPAHNBNRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2O3/c1-16-9-4-2-3-8(5-9)7-17-11(15)10-6-12(10,13)14/h2-5,10H,6-7H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate?
(3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate has a molecular weight of 275.13 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate is sourced from PubChem (CID 78790601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).