C15H18Cl2O4 — CID 78840809
(3-methoxy-4-propoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 78840809) has the molecular formula C15H18Cl2O4 and a molecular weight of 333.21 g/mol. Its IUPAC name is (3-methoxy-4-propoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate.
| Compound Name | (3-methoxy-4-propoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 78840809 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (3-methoxy-4-propoxyphenyl)methyl 2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | CCCOc1ccc(COC(=O)C2CC2(Cl)Cl)cc1OC |
| InChI | InChI=1S/C15H18Cl2O4/c1-3-6-20-12-5-4-10(7-13(12)19-2)9-21-14(18)11-8-15(11,16)17/h4-5,7,11H,3,6,8-9H2,1-2H3 |
| InChIKey | AVTYIPLFOMOOHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|