C18H30N2O3S — CID 162629982
(2R)-2-amino-N-[2-(3-methoxy-4-propoxyphenyl)ethyl]-3-methyl-3-methylsulfanylbutanamide (PubChem CID 162629982) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(3-methoxy-4-propoxyphenyl)ethyl]-3-methyl-3-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-(3-methoxy-4-propoxyphenyl)ethyl]-3-methyl-3-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 162629982 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2R)-2-amino-N-[2-(3-methoxy-4-propoxyphenyl)ethyl]-3-methyl-3-methylsulfanylbutanamide |
| SMILES | CCCOc1ccc(CCNC(=O)[C@@H](N)C(C)(C)SC)cc1OC |
| InChI | InChI=1S/C18H30N2O3S/c1-6-11-23-14-8-7-13(12-15(14)22-4)9-10-20-17(21)16(19)18(2,3)24-5/h7-8,12,16H,6,9-11,19H2,1-5H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | HNWSSFWJDCIPHS-MRXNPFEDSA-N |
| XLogP | 2.61 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |