C23H31ClN2O3 — CID 54099212
(2S)-2-amino-N-[2-[4-[3-(4-chlorophenyl)propoxy]-3-methoxyphenyl]ethyl]-3-methylbutanamide (PubChem CID 54099212) has the molecular formula C23H31ClN2O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[4-[3-(4-chlorophenyl)propoxy]-3-methoxyphenyl]ethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-[4-[3-(4-chlorophenyl)propoxy]-3-methoxyphenyl]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 54099212 |
| Molecular Formula | C23H31ClN2O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (2S)-2-amino-N-[2-[4-[3-(4-chlorophenyl)propoxy]-3-methoxyphenyl]ethyl]-3-methylbutanamide |
| SMILES | COc1cc(CCNC(=O)[C@@H](N)C(C)C)ccc1OCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H31ClN2O3/c1-16(2)22(25)23(27)26-13-12-18-8-11-20(21(15-18)28-3)29-14-4-5-17-6-9-19(24)10-7-17/h6-11,15-16,22H,4-5,12-14,25H2,1-3H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | MZIYQHBBINARDR-QFIPXVFZSA-N |
| XLogP | 4.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|