C17H29N3O3 — CID 119858639
(2S)-2-amino-N-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-methylbutanamide (PubChem CID 119858639) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 119858639 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2S)-2-amino-N-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl]-3-methylbutanamide |
| SMILES | COc1cc(CNC(=O)[C@@H](N)C(C)C)ccc1OCCN(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-12(2)16(18)17(21)19-11-13-6-7-14(15(10-13)22-5)23-9-8-20(3)4/h6-7,10,12,16H,8-9,11,18H2,1-5H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | UFJWBQLMGJQEJN-INIZCTEOSA-N |
| XLogP | 1.24 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |