C23H26ClNO5 — CID 139595354
2-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropoxy)-3-methoxyphenyl]ethyl]-2-prop-2-ynoxyacetamide (PubChem CID 139595354) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropoxy)-3-methoxyphenyl]ethyl]-2-prop-2-ynoxyacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropoxy)-3-methoxyphenyl]ethyl]-2-prop-2-ynoxyacetamide |
|---|---|
| PubChem CID | 139595354 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropoxy)-3-methoxyphenyl]ethyl]-2-prop-2-ynoxyacetamide |
| SMILES | C#CCOC(C(=O)NCCc1ccc(OCCCO)c(OC)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClNO5/c1-3-14-30-22(18-6-8-19(24)9-7-18)23(27)25-12-11-17-5-10-20(21(16-17)28-2)29-15-4-13-26/h1,5-10,16,22,26H,4,11-15H2,2H3,(H,25,27) |
| InChIKey | HZMGFJYBLANDDN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|