C21H23ClN2O4 — CID 142702312
2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyanilino)ethyl]-2-prop-2-ynoxyacetamide (PubChem CID 142702312) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyanilino)ethyl]-2-prop-2-ynoxyacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyanilino)ethyl]-2-prop-2-ynoxyacetamide |
|---|---|
| PubChem CID | 142702312 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyanilino)ethyl]-2-prop-2-ynoxyacetamide |
| SMILES | C#CCOC(C(=O)NCCNc1ccc(OC)c(OC)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-4-13-28-20(15-5-7-16(22)8-6-15)21(25)24-12-11-23-17-9-10-18(26-2)19(14-17)27-3/h1,5-10,14,20,23H,11-13H2,2-3H3,(H,24,25) |
| InChIKey | VUPXGVSLOBQKBL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|