C24H26ClNO4 — CID 87960236
(2S)-2-[(E)-but-2-enoxy]-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]acetamide (PubChem CID 87960236) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is (2S)-2-[(E)-but-2-enoxy]-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]acetamide.
| Compound Name | (2S)-2-[(E)-but-2-enoxy]-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 87960236 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (2S)-2-[(E)-but-2-enoxy]-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]acetamide |
| SMILES | C#CCOc1ccc(CCNC(=O)[C@@H](OC/C=C/C)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C24H26ClNO4/c1-4-6-16-30-23(19-8-10-20(25)11-9-19)24(27)26-14-13-18-7-12-21(29-15-5-2)22(17-18)28-3/h2,4,6-12,17,23H,13-16H2,1,3H3,(H,26,27)/b6-4+/t23-/m0/s1 |
| InChIKey | KBEVAXFMQSCBDA-DOHLAZSCSA-N |
| XLogP | 4.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|