C21H18Cl3NO3 — CID 20627121
3,3-dichloro-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]prop-2-enamide (PubChem CID 20627121) has the molecular formula C21H18Cl3NO3 and a molecular weight of 438.74 g/mol. Its IUPAC name is 3,3-dichloro-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | 3,3-dichloro-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 20627121 |
| Molecular Formula | C21H18Cl3NO3 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 3,3-dichloro-2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]prop-2-enamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(=C(Cl)Cl)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H18Cl3NO3/c1-3-12-28-17-9-4-14(13-18(17)27-2)10-11-25-21(26)19(20(23)24)15-5-7-16(22)8-6-15/h1,4-9,13H,10-12H2,2H3,(H,25,26) |
| InChIKey | RMTLCMHSGBGGBC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|