C23H22ClNO4 — CID 18412026
2-(4-chlorophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]pent-4-ynamide (PubChem CID 18412026) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]pent-4-ynamide.
| Compound Name | 2-(4-chlorophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]pent-4-ynamide |
|---|---|
| PubChem CID | 18412026 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]pent-4-ynamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(O)(CC#C)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C23H22ClNO4/c1-4-13-23(27,18-7-9-19(24)10-8-18)22(26)25-14-12-17-6-11-20(29-15-5-2)21(16-17)28-3/h1-2,6-11,16,27H,12-15H2,3H3,(H,25,26) |
| InChIKey | DPXPNNXHCRZENM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|