C25H26ClNO4S — CID 87905922
2-(4-chlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-prop-2-ynoxy-2-sulfanylacetamide (PubChem CID 87905922) has the molecular formula C25H26ClNO4S and a molecular weight of 472.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-prop-2-ynoxy-2-sulfanylacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-prop-2-ynoxy-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87905922 |
| Molecular Formula | C25H26ClNO4S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-prop-2-ynoxy-2-sulfanylacetamide |
| SMILES | C#CCOC(S)(C(=O)NCCc1ccc(OCC#CCC)c(OC)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClNO4S/c1-4-6-7-17-30-22-13-8-19(18-23(22)29-3)14-15-27-24(28)25(32,31-16-5-2)20-9-11-21(26)12-10-20/h2,8-13,18,32H,4,14-17H2,1,3H3,(H,27,28) |
| InChIKey | GRLMYZBFSAKHCK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|