C23H24Cl2N2O3S — CID 18405779
(2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide (PubChem CID 18405779) has the molecular formula C23H24Cl2N2O3S and a molecular weight of 479.43 g/mol. Its IUPAC name is (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide.
| Compound Name | (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide |
|---|---|
| PubChem CID | 18405779 |
| Molecular Formula | C23H24Cl2N2O3S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-pent-2-ynoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide |
| SMILES | CCC#CCOc1ccc(CCNC(=O)/C(=N/SC)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H24Cl2N2O3S/c1-4-5-6-13-30-20-10-7-16(14-21(20)29-2)11-12-26-23(28)22(27-31-3)17-8-9-18(24)19(25)15-17/h7-10,14-15H,4,11-13H2,1-3H3,(H,26,28)/b27-22+ |
| InChIKey | QTHNXLAJKBCYET-HPNDGRJYSA-N |
| XLogP | 5.22 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|