C22H25Cl2NO3 — CID 58819042
(E)-2-(3,4-dichlorophenyl)-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]pent-2-enamide (PubChem CID 58819042) has the molecular formula C22H25Cl2NO3 and a molecular weight of 422.35 g/mol. Its IUPAC name is (E)-2-(3,4-dichlorophenyl)-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]pent-2-enamide.
| Compound Name | (E)-2-(3,4-dichlorophenyl)-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]pent-2-enamide |
|---|---|
| PubChem CID | 58819042 |
| Molecular Formula | C22H25Cl2NO3 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (E)-2-(3,4-dichlorophenyl)-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]pent-2-enamide |
| SMILES | CC/C=C(/C(=O)NCCc1ccc(OCC)c(OC)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2NO3/c1-4-6-17(16-8-9-18(23)19(24)14-16)22(26)25-12-11-15-7-10-20(28-5-2)21(13-15)27-3/h6-10,13-14H,4-5,11-12H2,1-3H3,(H,25,26)/b17-6+ |
| InChIKey | UBOPQMMMYFPXHU-UBKPWBPPSA-N |
| XLogP | 5.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|