C21H22Cl2N2O3S — CID 18405783
(2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide (PubChem CID 18405783) has the molecular formula C21H22Cl2N2O3S and a molecular weight of 453.39 g/mol. Its IUPAC name is (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide.
| Compound Name | (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide |
|---|---|
| PubChem CID | 18405783 |
| Molecular Formula | C21H22Cl2N2O3S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | (2E)-2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-enoxyphenyl)ethyl]-2-methylsulfanyliminoacetamide |
| SMILES | C=CCOc1ccc(CCNC(=O)/C(=N/SC)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C21H22Cl2N2O3S/c1-4-11-28-18-8-5-14(12-19(18)27-2)9-10-24-21(26)20(25-29-3)15-6-7-16(22)17(23)13-15/h4-8,12-13H,1,9-11H2,2-3H3,(H,24,26)/b25-20+ |
| InChIKey | IYMFPFFTPRTGIX-LKUDQCMESA-N |
| XLogP | 4.99 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|