C24H22BrClN2O3 — CID 10864039
2-(4-bromophenyl)-2-(4-chlorophenyl)imino-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 10864039) has the molecular formula C24H22BrClN2O3 and a molecular weight of 501.81 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-(4-chlorophenyl)imino-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-2-(4-chlorophenyl)imino-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 10864039 |
| Molecular Formula | C24H22BrClN2O3 |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 2-(4-bromophenyl)-2-(4-chlorophenyl)imino-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)/C(=N/c2ccc(Cl)cc2)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C24H22BrClN2O3/c1-30-21-12-3-16(15-22(21)31-2)13-14-27-24(29)23(17-4-6-18(25)7-5-17)28-20-10-8-19(26)9-11-20/h3-12,15H,13-14H2,1-2H3,(H,27,29)/b28-23+ |
| InChIKey | AJSQGRDBZGBKFX-WEMUOSSPSA-N |
| XLogP | 5.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|