C26H28N2O3S — CID 18405788
(2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(4-methylphenyl)phenyl]-2-methylsulfanyliminoacetamide (PubChem CID 18405788) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(4-methylphenyl)phenyl]-2-methylsulfanyliminoacetamide.
| Compound Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(4-methylphenyl)phenyl]-2-methylsulfanyliminoacetamide |
|---|---|
| PubChem CID | 18405788 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(4-methylphenyl)phenyl]-2-methylsulfanyliminoacetamide |
| SMILES | COc1ccc(CCNC(=O)/C(=N\SC)c2ccc(-c3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C26H28N2O3S/c1-18-5-8-20(9-6-18)21-10-12-22(13-11-21)25(28-32-4)26(29)27-16-15-19-7-14-23(30-2)24(17-19)31-3/h5-14,17H,15-16H2,1-4H3,(H,27,29)/b28-25- |
| InChIKey | XTIDFHBRFZISFU-FVDSYPCUSA-N |
| XLogP | 5.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|