C18H18ClIN2O3 — CID 154039597
2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-iodoiminoacetamide (PubChem CID 154039597) has the molecular formula C18H18ClIN2O3 and a molecular weight of 472.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-iodoiminoacetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-iodoiminoacetamide |
|---|---|
| PubChem CID | 154039597 |
| Molecular Formula | C18H18ClIN2O3 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-iodoiminoacetamide |
| SMILES | COc1ccc(CCNC(=O)C(=NI)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H18ClIN2O3/c1-24-15-8-3-12(11-16(15)25-2)9-10-21-18(23)17(22-20)13-4-6-14(19)7-5-13/h3-8,11H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | GAXXNWXVOCQCHS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|