C22H26N2O4 — CID 72605566
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-hydroxyimino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 72605566) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-hydroxyimino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-hydroxyimino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 72605566 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-hydroxyimino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | COc1ccc(CCNC(=O)C(=NO)c2ccc3c(c2)CCCC3)cc1OC |
| InChI | InChI=1S/C22H26N2O4/c1-27-19-10-7-15(13-20(19)28-2)11-12-23-22(25)21(24-26)18-9-8-16-5-3-4-6-17(16)14-18/h7-10,13-14,26H,3-6,11-12H2,1-2H3,(H,23,25) |
| InChIKey | OMIYKAOZIFSJEU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|