C21H27N2O3+ — CID 8877243
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide (PubChem CID 8877243) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 8877243 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
| SMILES | COc1ccc(CCNC(=O)C[n+]2ccc3c(c2)CCCC3)cc1OC |
| InChI | InChI=1S/C21H26N2O3/c1-25-19-8-7-16(13-20(19)26-2)9-11-22-21(24)15-23-12-10-17-5-3-4-6-18(17)14-23/h7-8,10,12-14H,3-6,9,11,15H2,1-2H3/p+1 |
| InChIKey | RDDJQZAXCLAJQU-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|