C18H25NO4 — CID 101465774
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-oxocyclohexyl)acetamide (PubChem CID 101465774) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-oxocyclohexyl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-oxocyclohexyl)acetamide |
|---|---|
| PubChem CID | 101465774 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-oxocyclohexyl)acetamide |
| SMILES | COc1ccc(CCNC(=O)CC2CCCCC2=O)cc1OC |
| InChI | InChI=1S/C18H25NO4/c1-22-16-8-7-13(11-17(16)23-2)9-10-19-18(21)12-14-5-3-4-6-15(14)20/h7-8,11,14H,3-6,9-10,12H2,1-2H3,(H,19,21) |
| InChIKey | PJWKMSRFTPMCNR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |