C21H32N2O3 — CID 47006373
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 47006373) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 47006373 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2CCC3CCCCC3C2)cc1OC |
| InChI | InChI=1S/C21H32N2O3/c1-25-19-8-7-16(13-20(19)26-2)9-11-22-21(24)15-23-12-10-17-5-3-4-6-18(17)14-23/h7-8,13,17-18H,3-6,9-12,14-15H2,1-2H3,(H,22,24) |
| InChIKey | FRXTUKPKZWGEBX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |