C16H25N3O3 — CID 69348391
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-piperazin-2-ylacetamide (PubChem CID 69348391) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-piperazin-2-ylacetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-piperazin-2-ylacetamide |
|---|---|
| PubChem CID | 69348391 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-piperazin-2-ylacetamide |
| SMILES | COc1ccc(CCNC(=O)CC2CNCCN2)cc1OC |
| InChI | InChI=1S/C16H25N3O3/c1-21-14-4-3-12(9-15(14)22-2)5-6-19-16(20)10-13-11-17-7-8-18-13/h3-4,9,13,17-18H,5-8,10-11H2,1-2H3,(H,19,20) |
| InChIKey | PDHNABRZDIBOLO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |