C22H25NO6 — CID 27284886
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate (PubChem CID 27284886) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 27284886 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 3-methoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCC(=O)NCCc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C22H25NO6/c1-4-13-28-19-10-7-17(14-20(19)27-3)22(25)29-15-21(24)23-12-11-16-5-8-18(26-2)9-6-16/h4-10,14H,1,11-13,15H2,2-3H3,(H,23,24) |
| InChIKey | SHHAXSNHFSUDCO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|