C23H21Cl2NO3S — CID 23446799
2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-prop-2-ynylsulfanylacetamide (PubChem CID 23446799) has the molecular formula C23H21Cl2NO3S and a molecular weight of 462.40 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-prop-2-ynylsulfanylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-prop-2-ynylsulfanylacetamide |
|---|---|
| PubChem CID | 23446799 |
| Molecular Formula | C23H21Cl2NO3S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-prop-2-ynylsulfanylacetamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(SCC#C)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H21Cl2NO3S/c1-4-12-29-20-9-6-16(14-21(20)28-3)10-11-26-23(27)22(30-13-5-2)17-7-8-18(24)19(25)15-17/h1-2,6-9,14-15,22H,10-13H2,3H3,(H,26,27) |
| InChIKey | CYQDPTOWUCQSSW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|