C22H24FNO4S — CID 87905824
2-ethoxy-2-(4-fluorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-sulfanylacetamide (PubChem CID 87905824) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-ethoxy-2-(4-fluorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-sulfanylacetamide.
| Compound Name | 2-ethoxy-2-(4-fluorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87905824 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-ethoxy-2-(4-fluorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-sulfanylacetamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(S)(OCC)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C22H24FNO4S/c1-4-14-27-19-11-6-16(15-20(19)26-3)12-13-24-21(25)22(29,28-5-2)17-7-9-18(23)10-8-17/h1,6-11,15,29H,5,12-14H2,2-3H3,(H,24,25) |
| InChIKey | ZFOFRADHGCLTKK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|