C18H26NO5- — CID 9152045
4-[2-(3-methoxy-4-pentoxyphenyl)ethylamino]-4-oxobutanoate (PubChem CID 9152045) has the molecular formula C18H26NO5- and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-[2-(3-methoxy-4-pentoxyphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | 4-[2-(3-methoxy-4-pentoxyphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 9152045 |
| Molecular Formula | C18H26NO5- |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[2-(3-methoxy-4-pentoxyphenyl)ethylamino]-4-oxobutanoate |
| SMILES | CCCCCOc1ccc(CCNC(=O)CCC(=O)[O-])cc1OC |
| InChI | InChI=1S/C18H27NO5/c1-3-4-5-12-24-15-7-6-14(13-16(15)23-2)10-11-19-17(20)8-9-18(21)22/h6-7,13H,3-5,8-12H2,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | JAPIWQAJEBIQSG-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|