C17H26N2O5 — CID 42308252
4-[[4-[3-(dimethylazaniumyl)propoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoate (PubChem CID 42308252) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-[[4-[3-(dimethylazaniumyl)propoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoate.
| Compound Name | 4-[[4-[3-(dimethylazaniumyl)propoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42308252 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 4-[[4-[3-(dimethylazaniumyl)propoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoate |
| SMILES | COc1cc(CNC(=O)CCC(=O)[O-])ccc1OCCC[NH+](C)C |
| InChI | InChI=1S/C17H26N2O5/c1-19(2)9-4-10-24-14-6-5-13(11-15(14)23-3)12-18-16(20)7-8-17(21)22/h5-6,11H,4,7-10,12H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | SNEVBIYGQIQFRY-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|