C21H24NO5- — CID 9151455
4-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoate (PubChem CID 9151455) has the molecular formula C21H24NO5- and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoate.
| Compound Name | 4-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 9151455 |
| Molecular Formula | C21H24NO5- |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoate |
| SMILES | CCOc1cc(CNC(=O)CCC(=O)[O-])ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-3-26-19-12-17(13-22-20(23)10-11-21(24)25)8-9-18(19)27-14-16-6-4-15(2)5-7-16/h4-9,12H,3,10-11,13-14H2,1-2H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | YSAFTQYPYJGEBM-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |