C16H25NO4 — CID 42233463
3-[4-[2-(diethylazaniumyl)ethoxy]-3-methoxyphenyl]propanoate (PubChem CID 42233463) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[4-[2-(diethylazaniumyl)ethoxy]-3-methoxyphenyl]propanoate.
| Compound Name | 3-[4-[2-(diethylazaniumyl)ethoxy]-3-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 42233463 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-[4-[2-(diethylazaniumyl)ethoxy]-3-methoxyphenyl]propanoate |
| SMILES | CC[NH+](CC)CCOc1ccc(CCC(=O)[O-])cc1OC |
| InChI | InChI=1S/C16H25NO4/c1-4-17(5-2)10-11-21-14-8-6-13(7-9-16(18)19)12-15(14)20-3/h6,8,12H,4-5,7,9-11H2,1-3H3,(H,18,19) |
| InChIKey | BJPQKRLQSYREEC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |