C13H19NO4 — CID 28830380
3-[2-(3,4-dimethoxyphenyl)ethylazaniumyl]propanoate (PubChem CID 28830380) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylazaniumyl]propanoate.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylazaniumyl]propanoate |
|---|---|
| PubChem CID | 28830380 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylazaniumyl]propanoate |
| SMILES | COc1ccc(CC[NH2+]CCC(=O)[O-])cc1OC |
| InChI | InChI=1S/C13H19NO4/c1-17-11-4-3-10(9-12(11)18-2)5-7-14-8-6-13(15)16/h3-4,9,14H,5-8H2,1-2H3,(H,15,16) |
| InChIKey | OAMSOENGVPFFKL-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|