C18H19O4- — CID 7139445
2-[3-methoxy-4-(3-phenylpropoxy)phenyl]acetate (PubChem CID 7139445) has the molecular formula C18H19O4- and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]acetate.
| Compound Name | 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]acetate |
|---|---|
| PubChem CID | 7139445 |
| Molecular Formula | C18H19O4- |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[3-methoxy-4-(3-phenylpropoxy)phenyl]acetate |
| SMILES | COc1cc(CC(=O)[O-])ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C18H20O4/c1-21-17-12-15(13-18(19)20)9-10-16(17)22-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H,19,20)/p-1 |
| InChIKey | LDSYRJLBMYGNTC-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|