C19H23NO4 — CID 9152669
(3R)-3-azaniumyl-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]propanoate (PubChem CID 9152669) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3R)-3-azaniumyl-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]propanoate.
| Compound Name | (3R)-3-azaniumyl-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 9152669 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3R)-3-azaniumyl-3-[3-methoxy-4-(3-phenylpropoxy)phenyl]propanoate |
| SMILES | COc1cc([C@H]([NH3+])CC(=O)[O-])ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C19H23NO4/c1-23-18-12-15(16(20)13-19(21)22)9-10-17(18)24-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12,16H,5,8,11,13,20H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | ZILRNSSQGNRVOM-MRXNPFEDSA-N |
| XLogP | 1.13 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|