About (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate
(3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate (PubChem CID 78837283) has the molecular formula C18H19FO4
and a molecular weight of 318.34 g/mol. Its IUPAC name is (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate.
Molecular Properties
| Compound Name | (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate |
| PubChem CID | 78837283 |
| Molecular Formula | C18H19FO4 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate |
| SMILES | CCCOc1ccc(COC(=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H19FO4/c1-3-10-22-16-9-8-13(11-17(16)21-2)12-23-18(20)14-6-4-5-7-15(14)19/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | BQJRNEZGXKXQIE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate?
The IUPAC name of (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate (CID 78837283) is (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate.
What is the SMILES notation for (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate?
The canonical SMILES for (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate is CCCOc1ccc(COC(=O)c2ccccc2F)cc1OC.
What is the InChIKey of (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate?
The InChIKey is BQJRNEZGXKXQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FO4/c1-3-10-22-16-9-8-13(11-17(16)21-2)12-23-18(20)14-6-4-5-7-15(14)19/h4-9,11H,3,10,12H2,1-2H3.
What are the key properties of (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate?
(3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate has a molecular weight of 318.34 g/mol, XLogP of 3.98, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-4-propoxyphenyl)methyl 2-fluorobenzoate is sourced from PubChem (CID 78837283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).