C30H42N2O6 — CID 54777189
1-N,4-N-bis[(3-methoxy-4-propoxyphenyl)methyl]cyclohexane-1,4-dicarboxamide (PubChem CID 54777189) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is 1-N,4-N-bis[(3-methoxy-4-propoxyphenyl)methyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(3-methoxy-4-propoxyphenyl)methyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 54777189 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 1-N,4-N-bis[(3-methoxy-4-propoxyphenyl)methyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CCCOc1ccc(CNC(=O)C2CCC(C(=O)NCc3ccc(OCCC)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C30H42N2O6/c1-5-15-37-25-13-7-21(17-27(25)35-3)19-31-29(33)23-9-11-24(12-10-23)30(34)32-20-22-8-14-26(38-16-6-2)28(18-22)36-4/h7-8,13-14,17-18,23-24H,5-6,9-12,15-16,19-20H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | KTTLHVSHZNWZQM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |