C16H23NO2 — CID 110781731
N-[(3-ethyl-4-methoxyphenyl)methyl]cyclopentanecarboxamide (PubChem CID 110781731) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(3-ethyl-4-methoxyphenyl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(3-ethyl-4-methoxyphenyl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110781731 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(3-ethyl-4-methoxyphenyl)methyl]cyclopentanecarboxamide |
| SMILES | CCc1cc(CNC(=O)C2CCCC2)ccc1OC |
| InChI | InChI=1S/C16H23NO2/c1-3-13-10-12(8-9-15(13)19-2)11-17-16(18)14-6-4-5-7-14/h8-10,14H,3-7,11H2,1-2H3,(H,17,18) |
| InChIKey | YBHUITNWRXMUAH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |