C16H23NO4 — CID 95945674
N-[(2,3,4-trimethoxyphenyl)methyl]cyclopentanecarboxamide (PubChem CID 95945674) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(2,3,4-trimethoxyphenyl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(2,3,4-trimethoxyphenyl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 95945674 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(2,3,4-trimethoxyphenyl)methyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(CNC(=O)C2CCCC2)c(OC)c1OC |
| InChI | InChI=1S/C16H23NO4/c1-19-13-9-8-12(14(20-2)15(13)21-3)10-17-16(18)11-6-4-5-7-11/h8-9,11H,4-7,10H2,1-3H3,(H,17,18) |
| InChIKey | RUFTYKKUQIEPGI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |