C12H14Cl3NO4 — CID 67538566
2,2,2-trichloro-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide (PubChem CID 67538566) has the molecular formula C12H14Cl3NO4 and a molecular weight of 342.61 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 67538566 |
| Molecular Formula | C12H14Cl3NO4 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2,2,2-trichloro-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)C(Cl)(Cl)Cl)c(OC)c1OC |
| InChI | InChI=1S/C12H14Cl3NO4/c1-18-8-5-4-7(9(19-2)10(8)20-3)6-16-11(17)12(13,14)15/h4-5H,6H2,1-3H3,(H,16,17) |
| InChIKey | ODTSJBAINHMEDU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|