C15H16ClNO5 — CID 86925580
5-chloro-N-[(2,3,4-trimethoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 86925580) has the molecular formula C15H16ClNO5 and a molecular weight of 325.75 g/mol. Its IUPAC name is 5-chloro-N-[(2,3,4-trimethoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[(2,3,4-trimethoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86925580 |
| Molecular Formula | C15H16ClNO5 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-chloro-N-[(2,3,4-trimethoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Cl)o2)c(OC)c1OC |
| InChI | InChI=1S/C15H16ClNO5/c1-19-10-5-4-9(13(20-2)14(10)21-3)8-17-15(18)11-6-7-12(16)22-11/h4-7H,8H2,1-3H3,(H,17,18) |
| InChIKey | HFEHPJNCRYDSNL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |