C19H23NO5 — CID 94043014
2-(2-methylphenoxy)-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide (PubChem CID 94043014) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 94043014 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(2-methylphenoxy)-N-[(2,3,4-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)COc2ccccc2C)c(OC)c1OC |
| InChI | InChI=1S/C19H23NO5/c1-13-7-5-6-8-15(13)25-12-17(21)20-11-14-9-10-16(22-2)19(24-4)18(14)23-3/h5-10H,11-12H2,1-4H3,(H,20,21) |
| InChIKey | HPCJYFOEVRKVPD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |