About (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate
(3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate (PubChem CID 174537082) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate |
| PubChem CID | 174537082 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate |
| SMILES | C=C(O)C(=O)OCc1cccc(OC)c1 |
| InChI | InChI=1S/C11H12O4/c1-8(12)11(13)15-7-9-4-3-5-10(6-9)14-2/h3-6,12H,1,7H2,2H3 |
| InChIKey | YNWQWBHEEAHYNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate?
The IUPAC name of (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate (CID 174537082) is (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate?
The canonical SMILES for (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate is C=C(O)C(=O)OCc1cccc(OC)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate?
The InChIKey is YNWQWBHEEAHYNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-8(12)11(13)15-7-9-4-3-5-10(6-9)14-2/h3-6,12H,1,7H2,2H3.
What are the key properties of (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate?
(3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate has a molecular weight of 208.21 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2-hydroxyprop-2-enoate is sourced from PubChem (CID 174537082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).