About (3-methoxyphenyl)methyl pentanoate
(3-methoxyphenyl)methyl pentanoate (PubChem CID 78789338) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl pentanoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl pentanoate |
| PubChem CID | 78789338 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3-methoxyphenyl)methyl pentanoate |
| SMILES | CCCCC(=O)OCc1cccc(OC)c1 |
| InChI | InChI=1S/C13H18O3/c1-3-4-8-13(14)16-10-11-6-5-7-12(9-11)15-2/h5-7,9H,3-4,8,10H2,1-2H3 |
| InChIKey | KJPKIUSJKANCGY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methoxyphenyl)methyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl pentanoate?
The IUPAC name of (3-methoxyphenyl)methyl pentanoate (CID 78789338) is (3-methoxyphenyl)methyl pentanoate.
What is the SMILES notation for (3-methoxyphenyl)methyl pentanoate?
The canonical SMILES for (3-methoxyphenyl)methyl pentanoate is CCCCC(=O)OCc1cccc(OC)c1.
What is the InChIKey of (3-methoxyphenyl)methyl pentanoate?
The InChIKey is KJPKIUSJKANCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-3-4-8-13(14)16-10-11-6-5-7-12(9-11)15-2/h5-7,9H,3-4,8,10H2,1-2H3.
What are the key properties of (3-methoxyphenyl)methyl pentanoate?
(3-methoxyphenyl)methyl pentanoate has a molecular weight of 222.28 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl pentanoate is sourced from PubChem (CID 78789338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).