About (3-methoxyphenyl)methyl 2-sulfanylacetate
(3-methoxyphenyl)methyl 2-sulfanylacetate (PubChem CID 107018257) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 2-sulfanylacetate |
| PubChem CID | 107018257 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-sulfanylacetate |
| SMILES | COc1cccc(COC(=O)CS)c1 |
| InChI | InChI=1S/C10H12O3S/c1-12-9-4-2-3-8(5-9)6-13-10(11)7-14/h2-5,14H,6-7H2,1H3 |
| InChIKey | NSPCIWRFOYRSDE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl)methyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 2-sulfanylacetate?
The IUPAC name of (3-methoxyphenyl)methyl 2-sulfanylacetate (CID 107018257) is (3-methoxyphenyl)methyl 2-sulfanylacetate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2-sulfanylacetate?
The canonical SMILES for (3-methoxyphenyl)methyl 2-sulfanylacetate is COc1cccc(COC(=O)CS)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2-sulfanylacetate?
The InChIKey is NSPCIWRFOYRSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c1-12-9-4-2-3-8(5-9)6-13-10(11)7-14/h2-5,14H,6-7H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl 2-sulfanylacetate?
(3-methoxyphenyl)methyl 2-sulfanylacetate has a molecular weight of 212.27 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2-sulfanylacetate is sourced from PubChem (CID 107018257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).