About (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate
(3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 61277798) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 61277798 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | COc1cccc(COC(=O)[C@@H](N)C(C)C)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9(2)12(14)13(15)17-8-10-5-4-6-11(7-10)16-3/h4-7,9,12H,8,14H2,1-3H3/t12-/m0/s1 |
| InChIKey | GMERLTJZGBTQPD-LBPRGKRZSA-N |
| XLogP | 1.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate (CID 61277798) is (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate is COc1cccc(COC(=O)[C@@H](N)C(C)C)c1.
What is the InChIKey of (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate?
The InChIKey is GMERLTJZGBTQPD-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9(2)12(14)13(15)17-8-10-5-4-6-11(7-10)16-3/h4-7,9,12H,8,14H2,1-3H3/t12-/m0/s1.
What are the key properties of (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate?
(3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate has a molecular weight of 237.30 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 61277798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).