C19H23NO3 — CID 158335765
(3-phenoxyphenyl)methyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 158335765) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | (3-phenoxyphenyl)methyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 158335765 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (3-phenoxyphenyl)methyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-3-14(2)18(20)19(21)22-13-15-8-7-11-17(12-15)23-16-9-5-4-6-10-16/h4-12,14,18H,3,13,20H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | GQODBOYZRWQXJQ-KSSFIOAISA-N |
| XLogP | 3.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |