C22H26O5 — CID 91728129
5-O-(2-methylpropyl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate (PubChem CID 91728129) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-O-(2-methylpropyl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate.
| Compound Name | 5-O-(2-methylpropyl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
|---|---|
| PubChem CID | 91728129 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-O-(2-methylpropyl) 1-O-[(3-phenoxyphenyl)methyl] pentanedioate |
| SMILES | CC(C)COC(=O)CCCC(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H26O5/c1-17(2)15-25-21(23)12-7-13-22(24)26-16-18-8-6-11-20(14-18)27-19-9-4-3-5-10-19/h3-6,8-11,14,17H,7,12-13,15-16H2,1-2H3 |
| InChIKey | DTGOAXVCWRTXFL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |