C19H17F3O3 — CID 19793840
(3-phenoxyphenyl)methyl 5,6,6-trifluorohex-5-enoate (PubChem CID 19793840) has the molecular formula C19H17F3O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 5,6,6-trifluorohex-5-enoate.
| Compound Name | (3-phenoxyphenyl)methyl 5,6,6-trifluorohex-5-enoate |
|---|---|
| PubChem CID | 19793840 |
| Molecular Formula | C19H17F3O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (3-phenoxyphenyl)methyl 5,6,6-trifluorohex-5-enoate |
| SMILES | O=C(CCCC(F)=C(F)F)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H17F3O3/c20-17(19(21)22)10-5-11-18(23)24-13-14-6-4-9-16(12-14)25-15-7-2-1-3-8-15/h1-4,6-9,12H,5,10-11,13H2 |
| InChIKey | RVNQCUBGHADQLN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |